C14H13N3O2S2 — CID 106926276
3-[(4-methyl-1,3-oxazol-2-yl)sulfanylmethyl]-1-benzothiophene-2-carbohydrazide (PubChem CID 106926276) has the molecular formula C14H13N3O2S2 and a molecular weight of 319.41 g/mol. Its IUPAC name is 3-[(4-methyl-1,3-oxazol-2-yl)sulfanylmethyl]-1-benzothiophene-2-carbohydrazide.
| Compound Name | 3-[(4-methyl-1,3-oxazol-2-yl)sulfanylmethyl]-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 106926276 |
| Molecular Formula | C14H13N3O2S2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 3-[(4-methyl-1,3-oxazol-2-yl)sulfanylmethyl]-1-benzothiophene-2-carbohydrazide |
| SMILES | Cc1coc(SCc2c(C(=O)NN)sc3ccccc23)n1 |
| InChI | InChI=1S/C14H13N3O2S2/c1-8-6-19-14(16-8)20-7-10-9-4-2-3-5-11(9)21-12(10)13(18)17-15/h2-6H,7,15H2,1H3,(H,17,18) |
| InChIKey | GADINMAWFMXZKW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|