About 2-[(4-acetyl-2,2-diphenyl-3H-furan-5-yl)amino]ethyl 3-oxobutanoate
2-[(4-acetyl-2,2-diphenyl-3H-furan-5-yl)amino]ethyl 3-oxobutanoate (PubChem CID 10692771) has the molecular formula C24H25NO5
and a molecular weight of 407.47 g/mol. Its IUPAC name is 2-[(4-acetyl-2,2-diphenyl-3H-furan-5-yl)amino]ethyl 3-oxobutanoate.
Molecular Properties
| Compound Name | 2-[(4-acetyl-2,2-diphenyl-3H-furan-5-yl)amino]ethyl 3-oxobutanoate |
| PubChem CID | 10692771 |
| Molecular Formula | C24H25NO5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 2-[(4-acetyl-2,2-diphenyl-3H-furan-5-yl)amino]ethyl 3-oxobutanoate |
| SMILES | CC(=O)CC(=O)OCCNC1=C(C(C)=O)CC(c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C24H25NO5/c1-17(26)15-22(28)29-14-13-25-23-21(18(2)27)16-24(30-23,19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-12,25H,13-16H2,1-2H3 |
| InChIKey | FOJYAYZMGBQWIJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-acetyl-2,2-diphenyl-3H-furan-5-yl)amino]ethyl 3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-acetyl-2,2-diphenyl-3H-furan-5-yl)amino]ethyl 3-oxobutanoate?
The IUPAC name of 2-[(4-acetyl-2,2-diphenyl-3H-furan-5-yl)amino]ethyl 3-oxobutanoate (CID 10692771) is 2-[(4-acetyl-2,2-diphenyl-3H-furan-5-yl)amino]ethyl 3-oxobutanoate.
What is the SMILES notation for 2-[(4-acetyl-2,2-diphenyl-3H-furan-5-yl)amino]ethyl 3-oxobutanoate?
The canonical SMILES for 2-[(4-acetyl-2,2-diphenyl-3H-furan-5-yl)amino]ethyl 3-oxobutanoate is CC(=O)CC(=O)OCCNC1=C(C(C)=O)CC(c2ccccc2)(c2ccccc2)O1.
What is the InChIKey of 2-[(4-acetyl-2,2-diphenyl-3H-furan-5-yl)amino]ethyl 3-oxobutanoate?
The InChIKey is FOJYAYZMGBQWIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25NO5/c1-17(26)15-22(28)29-14-13-25-23-21(18(2)27)16-24(30-23,19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-12,25H,13-16H2,1-2H3.
What are the key properties of 2-[(4-acetyl-2,2-diphenyl-3H-furan-5-yl)amino]ethyl 3-oxobutanoate?
2-[(4-acetyl-2,2-diphenyl-3H-furan-5-yl)amino]ethyl 3-oxobutanoate has a molecular weight of 407.47 g/mol, XLogP of 3.26, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-acetyl-2,2-diphenyl-3H-furan-5-yl)amino]ethyl 3-oxobutanoate is sourced from PubChem (CID 10692771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).