C6H2Cl5N — CID 10693
2,3,4,5,6-pentachloroaniline (PubChem CID 10693) has the molecular formula C6H2Cl5N and a molecular weight of 265.35 g/mol. Its IUPAC name is 2,3,4,5,6-pentachloroaniline.
| Compound Name | 2,3,4,5,6-pentachloroaniline |
|---|---|
| PubChem CID | 10693 |
| Molecular Formula | C6H2Cl5N |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 262.86 |
| IUPAC Name | 2,3,4,5,6-pentachloroaniline |
| SMILES | Nc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C6H2Cl5N/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H2 |
| InChIKey | KHCZSJXTDDHLGJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|