C5H11F2NO — CID 106932381
(2R)-1-(2,2-difluoroethylamino)propan-2-ol (PubChem CID 106932381) has the molecular formula C5H11F2NO and a molecular weight of 139.15 g/mol. Its IUPAC name is (2R)-1-(2,2-difluoroethylamino)propan-2-ol.
| Compound Name | (2R)-1-(2,2-difluoroethylamino)propan-2-ol |
|---|---|
| PubChem CID | 106932381 |
| Molecular Formula | C5H11F2NO |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.08 |
| IUPAC Name | (2R)-1-(2,2-difluoroethylamino)propan-2-ol |
| SMILES | C[C@@H](O)CNCC(F)F |
| InChI | InChI=1S/C5H11F2NO/c1-4(9)2-8-3-5(6)7/h4-5,8-9H,2-3H2,1H3/t4-/m1/s1 |
| InChIKey | WRBSWTWIMNBBFH-SCSAIBSYSA-N |
| XLogP | 0.22 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |