C10H19NO2 — CID 106932829
8-[(2S)-2-hydroxypropyl]-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 106932829) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is 8-[(2S)-2-hydroxypropyl]-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | 8-[(2S)-2-hydroxypropyl]-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 106932829 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 8-[(2S)-2-hydroxypropyl]-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | C[C@H](O)CN1C2CCC1CC(O)C2 |
| InChI | InChI=1S/C10H19NO2/c1-7(12)6-11-8-2-3-9(11)5-10(13)4-8/h7-10,12-13H,2-6H2,1H3/t7-,8?,9?,10?/m0/s1 |
| InChIKey | ZXWQBHONDLDLFW-KJTVYLTBSA-N |
| XLogP | 0.35 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |