C26H43FOSi — CID 10693360
2-[(3E,7Z)-7-fluoro-3,8-dimethyl-14-trimethylsilyltetradeca-3,7-dien-12-ynyl]-1,3-dimethylcyclopent-2-en-1-ol (PubChem CID 10693360) has the molecular formula C26H43FOSi and a molecular weight of 418.71 g/mol. Its IUPAC name is 2-[(3E,7Z)-7-fluoro-3,8-dimethyl-14-trimethylsilyltetradeca-3,7-dien-12-ynyl]-1,3-dimethylcyclopent-2-en-1-ol.
| Compound Name | 2-[(3E,7Z)-7-fluoro-3,8-dimethyl-14-trimethylsilyltetradeca-3,7-dien-12-ynyl]-1,3-dimethylcyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 10693360 |
| Molecular Formula | C26H43FOSi |
| Molecular Weight | 418.71 g/mol |
| Exact Mass | 418.31 |
| IUPAC Name | 2-[(3E,7Z)-7-fluoro-3,8-dimethyl-14-trimethylsilyltetradeca-3,7-dien-12-ynyl]-1,3-dimethylcyclopent-2-en-1-ol |
| SMILES | CC1=C(CC/C(C)=C/CC/C(F)=C(\C)CCCC#CC[Si](C)(C)C)C(C)(O)CC1 |
| InChI | InChI=1S/C26H43FOSi/c1-21(16-17-24-22(2)18-19-26(24,4)28)13-12-15-25(27)23(3)14-10-8-9-11-20-29(5,6)7/h13,28H,8,10,12,14-20H2,1-7H3/b21-13+,25-23- |
| InChIKey | YOZFQQIPIPFKQF-RRJMXWIWSA-N |
| XLogP | 8.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.71 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|