About 3-(3-aminopropyl)-1-[(2,6-dichlorophenyl)methyl]pyrimidine-2,4-dione
3-(3-aminopropyl)-1-[(2,6-dichlorophenyl)methyl]pyrimidine-2,4-dione (PubChem CID 106933923) has the molecular formula C14H15Cl2N3O2
and a molecular weight of 328.20 g/mol. Its IUPAC name is 3-(3-aminopropyl)-1-[(2,6-dichlorophenyl)methyl]pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 3-(3-aminopropyl)-1-[(2,6-dichlorophenyl)methyl]pyrimidine-2,4-dione |
| PubChem CID | 106933923 |
| Molecular Formula | C14H15Cl2N3O2 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 3-(3-aminopropyl)-1-[(2,6-dichlorophenyl)methyl]pyrimidine-2,4-dione |
| SMILES | NCCCn1c(=O)ccn(Cc2c(Cl)cccc2Cl)c1=O |
| InChI | InChI=1S/C14H15Cl2N3O2/c15-11-3-1-4-12(16)10(11)9-18-8-5-13(20)19(14(18)21)7-2-6-17/h1,3-5,8H,2,6-7,9,17H2 |
| InChIKey | RNWGKHQLPPFXLR-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 70.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(3-aminopropyl)-1-[(2,6-dichlorophenyl)methyl]pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-aminopropyl)-1-[(2,6-dichlorophenyl)methyl]pyrimidine-2,4-dione?
The IUPAC name of 3-(3-aminopropyl)-1-[(2,6-dichlorophenyl)methyl]pyrimidine-2,4-dione (CID 106933923) is 3-(3-aminopropyl)-1-[(2,6-dichlorophenyl)methyl]pyrimidine-2,4-dione.
What is the SMILES notation for 3-(3-aminopropyl)-1-[(2,6-dichlorophenyl)methyl]pyrimidine-2,4-dione?
The canonical SMILES for 3-(3-aminopropyl)-1-[(2,6-dichlorophenyl)methyl]pyrimidine-2,4-dione is NCCCn1c(=O)ccn(Cc2c(Cl)cccc2Cl)c1=O.
What is the InChIKey of 3-(3-aminopropyl)-1-[(2,6-dichlorophenyl)methyl]pyrimidine-2,4-dione?
The InChIKey is RNWGKHQLPPFXLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15Cl2N3O2/c15-11-3-1-4-12(16)10(11)9-18-8-5-13(20)19(14(18)21)7-2-6-17/h1,3-5,8H,2,6-7,9,17H2.
What are the key properties of 3-(3-aminopropyl)-1-[(2,6-dichlorophenyl)methyl]pyrimidine-2,4-dione?
3-(3-aminopropyl)-1-[(2,6-dichlorophenyl)methyl]pyrimidine-2,4-dione has a molecular weight of 328.20 g/mol, XLogP of 1.71, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-aminopropyl)-1-[(2,6-dichlorophenyl)methyl]pyrimidine-2,4-dione is sourced from PubChem (CID 106933923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).