C16H27F3O5S2 — CID 10693436
(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-[(4S,5R)-2,2-dimethyl-5-[(2S)-1,1,1-trifluoro-3,3-bis(methylsulfanyl)propan-2-yl]-1,3-dioxolan-4-yl]methanol (PubChem CID 10693436) has the molecular formula C16H27F3O5S2 and a molecular weight of 420.52 g/mol. Its IUPAC name is (R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-[(4S,5R)-2,2-dimethyl-5-[(2S)-1,1,1-trifluoro-3,3-bis(methylsulfanyl)propan-2-yl]-1,3-dioxolan-4-yl]methanol.
| Compound Name | (R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-[(4S,5R)-2,2-dimethyl-5-[(2S)-1,1,1-trifluoro-3,3-bis(methylsulfanyl)propan-2-yl]-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 10693436 |
| Molecular Formula | C16H27F3O5S2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | (R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-[(4S,5R)-2,2-dimethyl-5-[(2S)-1,1,1-trifluoro-3,3-bis(methylsulfanyl)propan-2-yl]-1,3-dioxolan-4-yl]methanol |
| SMILES | CSC(SC)[C@@H]([C@H]1OC(C)(C)O[C@H]1[C@H](O)[C@H]1COC(C)(C)O1)C(F)(F)F |
| InChI | InChI=1S/C16H27F3O5S2/c1-14(2)21-7-8(22-14)10(20)12-11(23-15(3,4)24-12)9(16(17,18)19)13(25-5)26-6/h8-13,20H,7H2,1-6H3/t8-,9-,10-,11-,12+/m1/s1 |
| InChIKey | XMXPWWSWOJFRQT-OOCWMUITSA-N |
| XLogP | 3.25 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|