C12H10Cl3N3 — CID 106935218
2,4,5-trichloro-N-[(1-ethenylpyrazol-4-yl)methyl]aniline (PubChem CID 106935218) has the molecular formula C12H10Cl3N3 and a molecular weight of 302.59 g/mol. Its IUPAC name is 2,4,5-trichloro-N-[(1-ethenylpyrazol-4-yl)methyl]aniline.
| Compound Name | 2,4,5-trichloro-N-[(1-ethenylpyrazol-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 106935218 |
| Molecular Formula | C12H10Cl3N3 |
| Molecular Weight | 302.59 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | 2,4,5-trichloro-N-[(1-ethenylpyrazol-4-yl)methyl]aniline |
| SMILES | C=Cn1cc(CNc2cc(Cl)c(Cl)cc2Cl)cn1 |
| InChI | InChI=1S/C12H10Cl3N3/c1-2-18-7-8(6-17-18)5-16-12-4-10(14)9(13)3-11(12)15/h2-4,6-7,16H,1,5H2 |
| InChIKey | NMACROBPSHBXFV-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.59 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|