C21H26O5S2 — CID 10693535
methyl (2Z,4R,5S,6E)-5-acetyloxy-7-(1,3-dithian-2-yl)-4-phenylmethoxyhepta-2,6-dienoate (PubChem CID 10693535) has the molecular formula C21H26O5S2 and a molecular weight of 422.57 g/mol. Its IUPAC name is methyl (2Z,4R,5S,6E)-5-acetyloxy-7-(1,3-dithian-2-yl)-4-phenylmethoxyhepta-2,6-dienoate.
| Compound Name | methyl (2Z,4R,5S,6E)-5-acetyloxy-7-(1,3-dithian-2-yl)-4-phenylmethoxyhepta-2,6-dienoate |
|---|---|
| PubChem CID | 10693535 |
| Molecular Formula | C21H26O5S2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | methyl (2Z,4R,5S,6E)-5-acetyloxy-7-(1,3-dithian-2-yl)-4-phenylmethoxyhepta-2,6-dienoate |
| SMILES | COC(=O)/C=C\[C@@H](OCc1ccccc1)[C@H](/C=C/C1SCCCS1)OC(C)=O |
| InChI | InChI=1S/C21H26O5S2/c1-16(22)26-19(10-12-21-27-13-6-14-28-21)18(9-11-20(23)24-2)25-15-17-7-4-3-5-8-17/h3-5,7-12,18-19,21H,6,13-15H2,1-2H3/b11-9-,12-10+/t18-,19+/m1/s1 |
| InChIKey | LEPHUJMUUOWVBP-DNXUGUBLSA-N |
| XLogP | 3.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|