C13H11F4N3 — CID 106936642
N-[(1-ethenylpyrazol-4-yl)methyl]-4-fluoro-3-(trifluoromethyl)aniline (PubChem CID 106936642) has the molecular formula C13H11F4N3 and a molecular weight of 285.24 g/mol. Its IUPAC name is N-[(1-ethenylpyrazol-4-yl)methyl]-4-fluoro-3-(trifluoromethyl)aniline.
| Compound Name | N-[(1-ethenylpyrazol-4-yl)methyl]-4-fluoro-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 106936642 |
| Molecular Formula | C13H11F4N3 |
| Molecular Weight | 285.24 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | N-[(1-ethenylpyrazol-4-yl)methyl]-4-fluoro-3-(trifluoromethyl)aniline |
| SMILES | C=Cn1cc(CNc2ccc(F)c(C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C13H11F4N3/c1-2-20-8-9(7-19-20)6-18-10-3-4-12(14)11(5-10)13(15,16)17/h2-5,7-8,18H,1,6H2 |
| InChIKey | LHORQKNPXVQEOX-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.24 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |