C25H35NO3Si — CID 10693689
tert-butyl N-[(2S,3R)-3-[dimethyl(phenyl)silyl]-3-hydroxy-1-phenylhex-5-en-2-yl]carbamate (PubChem CID 10693689) has the molecular formula C25H35NO3Si and a molecular weight of 425.65 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-3-[dimethyl(phenyl)silyl]-3-hydroxy-1-phenylhex-5-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-3-[dimethyl(phenyl)silyl]-3-hydroxy-1-phenylhex-5-en-2-yl]carbamate |
|---|---|
| PubChem CID | 10693689 |
| Molecular Formula | C25H35NO3Si |
| Molecular Weight | 425.65 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | tert-butyl N-[(2S,3R)-3-[dimethyl(phenyl)silyl]-3-hydroxy-1-phenylhex-5-en-2-yl]carbamate |
| SMILES | C=CC[C@](O)([C@H](Cc1ccccc1)NC(=O)OC(C)(C)C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C25H35NO3Si/c1-7-18-25(28,30(5,6)21-16-12-9-13-17-21)22(19-20-14-10-8-11-15-20)26-23(27)29-24(2,3)4/h7-17,22,28H,1,18-19H2,2-6H3,(H,26,27)/t22-,25+/m0/s1 |
| InChIKey | GGLKVOLRWCUSNU-WIOPSUGQSA-N |
| XLogP | 4.58 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.65 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|