C11H16F3N3 — CID 106937156
N-[(1-ethenylpyrazol-4-yl)methyl]-5,5,5-trifluoropentan-1-amine (PubChem CID 106937156) has the molecular formula C11H16F3N3 and a molecular weight of 247.26 g/mol. Its IUPAC name is N-[(1-ethenylpyrazol-4-yl)methyl]-5,5,5-trifluoropentan-1-amine.
| Compound Name | N-[(1-ethenylpyrazol-4-yl)methyl]-5,5,5-trifluoropentan-1-amine |
|---|---|
| PubChem CID | 106937156 |
| Molecular Formula | C11H16F3N3 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | N-[(1-ethenylpyrazol-4-yl)methyl]-5,5,5-trifluoropentan-1-amine |
| SMILES | C=Cn1cc(CNCCCCC(F)(F)F)cn1 |
| InChI | InChI=1S/C11H16F3N3/c1-2-17-9-10(8-16-17)7-15-6-4-3-5-11(12,13)14/h2,8-9,15H,1,3-7H2 |
| InChIKey | MEBDSVDAUSFFLR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|