C28H34Si2 — CID 10693743
trimethyl-(13-trimethylsilyl-12-pentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,12,17,19,21-nonaenyl)silane (PubChem CID 10693743) has the molecular formula C28H34Si2 and a molecular weight of 426.75 g/mol. Its IUPAC name is trimethyl-(13-trimethylsilyl-12-pentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,12,17,19,21-nonaenyl)silane.
| Compound Name | trimethyl-(13-trimethylsilyl-12-pentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,12,17,19,21-nonaenyl)silane |
|---|---|
| PubChem CID | 10693743 |
| Molecular Formula | C28H34Si2 |
| Molecular Weight | 426.75 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | trimethyl-(13-trimethylsilyl-12-pentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,12,17,19,21-nonaenyl)silane |
| SMILES | C[Si](C)(C)c1c2c(c3c(c1[Si](C)(C)C)CCc1ccccc1-3)-c1ccccc1CC2 |
| InChI | InChI=1S/C28H34Si2/c1-29(2,3)27-23-17-15-19-11-7-9-13-21(19)25(23)26-22-14-10-8-12-20(22)16-18-24(26)28(27)30(4,5)6/h7-14H,15-18H2,1-6H3 |
| InChIKey | JFYRUUCYAZJCRW-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.75 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|