C13H25N3O3 — CID 106938268
2-[(1-aminocyclohexyl)methoxy]-N-(ethylcarbamoyl)propanamide (PubChem CID 106938268) has the molecular formula C13H25N3O3 and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-[(1-aminocyclohexyl)methoxy]-N-(ethylcarbamoyl)propanamide.
| Compound Name | 2-[(1-aminocyclohexyl)methoxy]-N-(ethylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 106938268 |
| Molecular Formula | C13H25N3O3 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 2-[(1-aminocyclohexyl)methoxy]-N-(ethylcarbamoyl)propanamide |
| SMILES | CCNC(=O)NC(=O)C(C)OCC1(N)CCCCC1 |
| InChI | InChI=1S/C13H25N3O3/c1-3-15-12(18)16-11(17)10(2)19-9-13(14)7-5-4-6-8-13/h10H,3-9,14H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | AYLMJAPWQGLVCJ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |