C23H26O6S — CID 10693941
diethyl (1S,2R,3R)-1-(4-methylphenyl)sulfonyl-1,2,3,4-tetrahydronaphthalene-2,3-dicarboxylate (PubChem CID 10693941) has the molecular formula C23H26O6S and a molecular weight of 430.52 g/mol. Its IUPAC name is diethyl (1S,2R,3R)-1-(4-methylphenyl)sulfonyl-1,2,3,4-tetrahydronaphthalene-2,3-dicarboxylate.
| Compound Name | diethyl (1S,2R,3R)-1-(4-methylphenyl)sulfonyl-1,2,3,4-tetrahydronaphthalene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 10693941 |
| Molecular Formula | C23H26O6S |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | diethyl (1S,2R,3R)-1-(4-methylphenyl)sulfonyl-1,2,3,4-tetrahydronaphthalene-2,3-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H](S(=O)(=O)c2ccc(C)cc2)c2ccccc2C[C@H]1C(=O)OCC |
| InChI | InChI=1S/C23H26O6S/c1-4-28-22(24)19-14-16-8-6-7-9-18(16)21(20(19)23(25)29-5-2)30(26,27)17-12-10-15(3)11-13-17/h6-13,19-21H,4-5,14H2,1-3H3/t19-,20+,21-/m1/s1 |
| InChIKey | GWNFEDRGBBIUNF-QHAWAJNXSA-N |
| XLogP | 3.42 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |