About 3-chloro-8-[(2,6-dibromophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine
3-chloro-8-[(2,6-dibromophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine (PubChem CID 10693943) has the molecular formula C15H11Br2ClN2O
and a molecular weight of 430.53 g/mol. Its IUPAC name is 3-chloro-8-[(2,6-dibromophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 3-chloro-8-[(2,6-dibromophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine |
| PubChem CID | 10693943 |
| Molecular Formula | C15H11Br2ClN2O |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 427.89 |
| IUPAC Name | 3-chloro-8-[(2,6-dibromophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine |
| SMILES | Cc1nc2c(OCc3c(Br)cccc3Br)cccn2c1Cl |
| InChI | InChI=1S/C15H11Br2ClN2O/c1-9-14(18)20-7-3-6-13(15(20)19-9)21-8-10-11(16)4-2-5-12(10)17/h2-7H,8H2,1H3 |
| InChIKey | TUZRQJHJLAQVTJ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-chloro-8-[(2,6-dibromophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-8-[(2,6-dibromophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine?
The IUPAC name of 3-chloro-8-[(2,6-dibromophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine (CID 10693943) is 3-chloro-8-[(2,6-dibromophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine.
What is the SMILES notation for 3-chloro-8-[(2,6-dibromophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine?
The canonical SMILES for 3-chloro-8-[(2,6-dibromophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine is Cc1nc2c(OCc3c(Br)cccc3Br)cccn2c1Cl.
What is the InChIKey of 3-chloro-8-[(2,6-dibromophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine?
The InChIKey is TUZRQJHJLAQVTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11Br2ClN2O/c1-9-14(18)20-7-3-6-13(15(20)19-9)21-8-10-11(16)4-2-5-12(10)17/h2-7H,8H2,1H3.
What are the key properties of 3-chloro-8-[(2,6-dibromophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine?
3-chloro-8-[(2,6-dibromophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine has a molecular weight of 430.53 g/mol, XLogP of 5.40, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-8-[(2,6-dibromophenyl)methoxy]-2-methylimidazo[1,2-a]pyridine is sourced from PubChem (CID 10693943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).