About 2,3,5,6-tetramethylphenol
2,3,5,6-tetramethylphenol (PubChem CID 10694) has the molecular formula C10H14O
and a molecular weight of 150.22 g/mol. Its IUPAC name is 2,3,5,6-tetramethylphenol.
Molecular Properties
| Compound Name | 2,3,5,6-tetramethylphenol |
| PubChem CID | 10694 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 2,3,5,6-tetramethylphenol |
| SMILES | Cc1cc(C)c(C)c(O)c1C |
| InChI | InChI=1S/C10H14O/c1-6-5-7(2)9(4)10(11)8(6)3/h5,11H,1-4H3 |
| InChIKey | KLAQSPUVCDBEGF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3,5,6-tetramethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,5,6-tetramethylphenol?
The IUPAC name of 2,3,5,6-tetramethylphenol (CID 10694) is 2,3,5,6-tetramethylphenol.
What is the SMILES notation for 2,3,5,6-tetramethylphenol?
The canonical SMILES for 2,3,5,6-tetramethylphenol is Cc1cc(C)c(C)c(O)c1C.
What is the InChIKey of 2,3,5,6-tetramethylphenol?
The InChIKey is KLAQSPUVCDBEGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O/c1-6-5-7(2)9(4)10(11)8(6)3/h5,11H,1-4H3.
What are the key properties of 2,3,5,6-tetramethylphenol?
2,3,5,6-tetramethylphenol has a molecular weight of 150.22 g/mol, XLogP of 2.63, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,5,6-tetramethylphenol is sourced from PubChem (CID 10694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).