About 4-(3-aminocyclobutyl)oxy-1,1-dioxothiolan-3-ol
4-(3-aminocyclobutyl)oxy-1,1-dioxothiolan-3-ol (PubChem CID 106940395) has the molecular formula C8H15NO4S
and a molecular weight of 221.28 g/mol. Its IUPAC name is 4-(3-aminocyclobutyl)oxy-1,1-dioxothiolan-3-ol.
Molecular Properties
| Compound Name | 4-(3-aminocyclobutyl)oxy-1,1-dioxothiolan-3-ol |
| PubChem CID | 106940395 |
| Molecular Formula | C8H15NO4S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 4-(3-aminocyclobutyl)oxy-1,1-dioxothiolan-3-ol |
| SMILES | NC1CC(OC2CS(=O)(=O)CC2O)C1 |
| InChI | InChI=1S/C8H15NO4S/c9-5-1-6(2-5)13-8-4-14(11,12)3-7(8)10/h5-8,10H,1-4,9H2 |
| InChIKey | HGPZBQIXZJLPFA-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(3-aminocyclobutyl)oxy-1,1-dioxothiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-aminocyclobutyl)oxy-1,1-dioxothiolan-3-ol?
The IUPAC name of 4-(3-aminocyclobutyl)oxy-1,1-dioxothiolan-3-ol (CID 106940395) is 4-(3-aminocyclobutyl)oxy-1,1-dioxothiolan-3-ol.
What is the SMILES notation for 4-(3-aminocyclobutyl)oxy-1,1-dioxothiolan-3-ol?
The canonical SMILES for 4-(3-aminocyclobutyl)oxy-1,1-dioxothiolan-3-ol is NC1CC(OC2CS(=O)(=O)CC2O)C1.
What is the InChIKey of 4-(3-aminocyclobutyl)oxy-1,1-dioxothiolan-3-ol?
The InChIKey is HGPZBQIXZJLPFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO4S/c9-5-1-6(2-5)13-8-4-14(11,12)3-7(8)10/h5-8,10H,1-4,9H2.
What are the key properties of 4-(3-aminocyclobutyl)oxy-1,1-dioxothiolan-3-ol?
4-(3-aminocyclobutyl)oxy-1,1-dioxothiolan-3-ol has a molecular weight of 221.28 g/mol, XLogP of -1.35, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-aminocyclobutyl)oxy-1,1-dioxothiolan-3-ol is sourced from PubChem (CID 106940395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).