C24H31FO6 — CID 10694132
2-[(1S,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethyl 2-fluorobenzoate (PubChem CID 10694132) has the molecular formula C24H31FO6 and a molecular weight of 434.50 g/mol. Its IUPAC name is 2-[(1S,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethyl 2-fluorobenzoate.
| Compound Name | 2-[(1S,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethyl 2-fluorobenzoate |
|---|---|
| PubChem CID | 10694132 |
| Molecular Formula | C24H31FO6 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 2-[(1S,4S,5R,8S,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethyl 2-fluorobenzoate |
| SMILES | C[C@H]1[C@@H](CCOC(=O)c2ccccc2F)O[C@@H]2O[C@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C24H31FO6/c1-14-8-9-18-15(2)20(11-13-27-21(26)16-6-4-5-7-19(16)25)28-22-24(18)17(14)10-12-23(3,29-22)30-31-24/h4-7,14-15,17-18,20,22H,8-13H2,1-3H3/t14-,15-,17+,18+,20-,22-,23+,24-/m1/s1 |
| InChIKey | BFZBFHSVPHQDPD-ATNZXWSXSA-N |
| XLogP | 4.62 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|