C22H30BrNO3 — CID 10694199
2-bromo-N-[2-[(8S,9S,11R,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]ethyl]acetamide (PubChem CID 10694199) has the molecular formula C22H30BrNO3 and a molecular weight of 436.39 g/mol. Its IUPAC name is 2-bromo-N-[2-[(8S,9S,11R,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]ethyl]acetamide.
| Compound Name | 2-bromo-N-[2-[(8S,9S,11R,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 10694199 |
| Molecular Formula | C22H30BrNO3 |
| Molecular Weight | 436.39 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 2-bromo-N-[2-[(8S,9S,11R,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]ethyl]acetamide |
| SMILES | C[C@]12C[C@H](CCNC(=O)CBr)[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C22H30BrNO3/c1-22-11-14(8-9-24-20(27)12-23)21-16-5-3-15(25)10-13(16)2-4-17(21)18(22)6-7-19(22)26/h3,5,10,14,17-19,21,25-26H,2,4,6-9,11-12H2,1H3,(H,24,27)/t14-,17-,18-,19-,21+,22-/m0/s1 |
| InChIKey | SVKNUKFNBSYJOH-GAWRCDSNSA-N |
| XLogP | 3.74 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|