C22H23N5O5 — CID 10694254
tert-butyl 4-acetamido-3-[2-amino-4-(3-nitrophenyl)imidazol-1-yl]benzoate (PubChem CID 10694254) has the molecular formula C22H23N5O5 and a molecular weight of 437.46 g/mol. Its IUPAC name is tert-butyl 4-acetamido-3-[2-amino-4-(3-nitrophenyl)imidazol-1-yl]benzoate.
| Compound Name | tert-butyl 4-acetamido-3-[2-amino-4-(3-nitrophenyl)imidazol-1-yl]benzoate |
|---|---|
| PubChem CID | 10694254 |
| Molecular Formula | C22H23N5O5 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | tert-butyl 4-acetamido-3-[2-amino-4-(3-nitrophenyl)imidazol-1-yl]benzoate |
| SMILES | CC(=O)Nc1ccc(C(=O)OC(C)(C)C)cc1-n1cc(-c2cccc([N+](=O)[O-])c2)nc1N |
| InChI | InChI=1S/C22H23N5O5/c1-13(28)24-17-9-8-15(20(29)32-22(2,3)4)11-19(17)26-12-18(25-21(26)23)14-6-5-7-16(10-14)27(30)31/h5-12H,1-4H3,(H2,23,25)(H,24,28) |
| InChIKey | FDCLXYYWNGNOGM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 142.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|