C26H31NO5 — CID 10694271
(2S,3S,4S)-3-(carboxymethyl)-4-[1-[4-(5-phenylpentoxy)phenyl]ethenyl]pyrrolidine-2-carboxylic acid (PubChem CID 10694271) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is (2S,3S,4S)-3-(carboxymethyl)-4-[1-[4-(5-phenylpentoxy)phenyl]ethenyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3S,4S)-3-(carboxymethyl)-4-[1-[4-(5-phenylpentoxy)phenyl]ethenyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 10694271 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | (2S,3S,4S)-3-(carboxymethyl)-4-[1-[4-(5-phenylpentoxy)phenyl]ethenyl]pyrrolidine-2-carboxylic acid |
| SMILES | C=C(c1ccc(OCCCCCc2ccccc2)cc1)[C@H]1CN[C@H](C(=O)O)[C@H]1CC(=O)O |
| InChI | InChI=1S/C26H31NO5/c1-18(23-17-27-25(26(30)31)22(23)16-24(28)29)20-11-13-21(14-12-20)32-15-7-3-6-10-19-8-4-2-5-9-19/h2,4-5,8-9,11-14,22-23,25,27H,1,3,6-7,10,15-17H2,(H,28,29)(H,30,31)/t22-,23+,25-/m0/s1 |
| InChIKey | KQZLIJXFHUULGQ-ARNLJNQMSA-N |
| XLogP | 4.26 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|