C13H17BrF2N2O — CID 106942771
1-(3-bromo-2,6-difluorophenyl)-N-methyl-1-(4-methylmorpholin-2-yl)methanamine (PubChem CID 106942771) has the molecular formula C13H17BrF2N2O and a molecular weight of 335.19 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-N-methyl-1-(4-methylmorpholin-2-yl)methanamine.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-N-methyl-1-(4-methylmorpholin-2-yl)methanamine |
|---|---|
| PubChem CID | 106942771 |
| Molecular Formula | C13H17BrF2N2O |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-N-methyl-1-(4-methylmorpholin-2-yl)methanamine |
| SMILES | CNC(c1c(F)ccc(Br)c1F)C1CN(C)CCO1 |
| InChI | InChI=1S/C13H17BrF2N2O/c1-17-13(10-7-18(2)5-6-19-10)11-9(15)4-3-8(14)12(11)16/h3-4,10,13,17H,5-7H2,1-2H3 |
| InChIKey | AJMAJEIILCWCFR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|