C25H35N3O2Si — CID 10694285
[5-(benzotriazol-1-yl)-5-ethoxy-7-(4-methylphenyl)hept-1-en-2-yl]oxy-trimethylsilane (PubChem CID 10694285) has the molecular formula C25H35N3O2Si and a molecular weight of 437.66 g/mol. Its IUPAC name is [5-(benzotriazol-1-yl)-5-ethoxy-7-(4-methylphenyl)hept-1-en-2-yl]oxy-trimethylsilane.
| Compound Name | [5-(benzotriazol-1-yl)-5-ethoxy-7-(4-methylphenyl)hept-1-en-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 10694285 |
| Molecular Formula | C25H35N3O2Si |
| Molecular Weight | 437.66 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | [5-(benzotriazol-1-yl)-5-ethoxy-7-(4-methylphenyl)hept-1-en-2-yl]oxy-trimethylsilane |
| SMILES | C=C(CCC(CCc1ccc(C)cc1)(OCC)n1nnc2ccccc21)O[Si](C)(C)C |
| InChI | InChI=1S/C25H35N3O2Si/c1-7-29-25(18-16-21(3)30-31(4,5)6,19-17-22-14-12-20(2)13-15-22)28-24-11-9-8-10-23(24)26-27-28/h8-15H,3,7,16-19H2,1-2,4-6H3 |
| InChIKey | BOMFZDLSWZIBQJ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.66 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|