C27H23FN4O — CID 10694315
2-(4-fluorophenyl)-4-(3-phenylpropoxy)-3-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-6-amine (PubChem CID 10694315) has the molecular formula C27H23FN4O and a molecular weight of 438.51 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-(3-phenylpropoxy)-3-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-6-amine.
| Compound Name | 2-(4-fluorophenyl)-4-(3-phenylpropoxy)-3-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-6-amine |
|---|---|
| PubChem CID | 10694315 |
| Molecular Formula | C27H23FN4O |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 2-(4-fluorophenyl)-4-(3-phenylpropoxy)-3-pyridin-4-yl-1H-pyrrolo[2,3-b]pyridin-6-amine |
| SMILES | Nc1cc(OCCCc2ccccc2)c2c(-c3ccncc3)c(-c3ccc(F)cc3)[nH]c2n1 |
| InChI | InChI=1S/C27H23FN4O/c28-21-10-8-20(9-11-21)26-24(19-12-14-30-15-13-19)25-22(17-23(29)31-27(25)32-26)33-16-4-7-18-5-2-1-3-6-18/h1-3,5-6,8-15,17H,4,7,16H2,(H3,29,31,32) |
| InChIKey | FDVXDXGMVYUYFV-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|