C10H6BrF2N3 — CID 106943753
6-(3-bromo-2,6-difluorophenyl)pyrazin-2-amine (PubChem CID 106943753) has the molecular formula C10H6BrF2N3 and a molecular weight of 286.08 g/mol. Its IUPAC name is 6-(3-bromo-2,6-difluorophenyl)pyrazin-2-amine.
| Compound Name | 6-(3-bromo-2,6-difluorophenyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 106943753 |
| Molecular Formula | C10H6BrF2N3 |
| Molecular Weight | 286.08 g/mol |
| Exact Mass | 284.97 |
| IUPAC Name | 6-(3-bromo-2,6-difluorophenyl)pyrazin-2-amine |
| SMILES | Nc1cncc(-c2c(F)ccc(Br)c2F)n1 |
| InChI | InChI=1S/C10H6BrF2N3/c11-5-1-2-6(12)9(10(5)13)7-3-15-4-8(14)16-7/h1-4H,(H2,14,16) |
| InChIKey | LGYNOHPLEZCHQH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.08 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|