C18H14N2O2S2 — CID 1069448
2,5-bis(4-methoxyphenyl)-[1,3]thiazolo[5,4-d][1,3]thiazole (PubChem CID 1069448) has the molecular formula C18H14N2O2S2 and a molecular weight of 354.46 g/mol. Its IUPAC name is 2,5-bis(4-methoxyphenyl)-[1,3]thiazolo[5,4-d][1,3]thiazole.
| Compound Name | 2,5-bis(4-methoxyphenyl)-[1,3]thiazolo[5,4-d][1,3]thiazole |
|---|---|
| PubChem CID | 1069448 |
| Molecular Formula | C18H14N2O2S2 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 2,5-bis(4-methoxyphenyl)-[1,3]thiazolo[5,4-d][1,3]thiazole |
| SMILES | COc1ccc(-c2nc3sc(-c4ccc(OC)cc4)nc3s2)cc1 |
| InChI | InChI=1S/C18H14N2O2S2/c1-21-13-7-3-11(4-8-13)15-19-17-18(23-15)20-16(24-17)12-5-9-14(22-2)10-6-12/h3-10H,1-2H3 |
| InChIKey | VAFUTAPLEGLTOX-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |