About benzyl (3R)-1-benzyl-5-methoxy-2-oxospiro[indole-3,3'-pyrrolidine]-1'-carboxylate
benzyl (3R)-1-benzyl-5-methoxy-2-oxospiro[indole-3,3'-pyrrolidine]-1'-carboxylate (PubChem CID 10694495) has the molecular formula C27H26N2O4
and a molecular weight of 442.52 g/mol. Its IUPAC name is benzyl (3R)-1-benzyl-5-methoxy-2-oxospiro[indole-3,3'-pyrrolidine]-1'-carboxylate.
Molecular Properties
| Compound Name | benzyl (3R)-1-benzyl-5-methoxy-2-oxospiro[indole-3,3'-pyrrolidine]-1'-carboxylate |
| PubChem CID | 10694495 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | benzyl (3R)-1-benzyl-5-methoxy-2-oxospiro[indole-3,3'-pyrrolidine]-1'-carboxylate |
| SMILES | COc1ccc2c(c1)[C@@]1(CCN(C(=O)OCc3ccccc3)C1)C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C27H26N2O4/c1-32-22-12-13-24-23(16-22)27(25(30)29(24)17-20-8-4-2-5-9-20)14-15-28(19-27)26(31)33-18-21-10-6-3-7-11-21/h2-13,16H,14-15,17-19H2,1H3/t27-/m0/s1 |
| InChIKey | IELIIVJBHWMKTI-MHZLTWQESA-N |
| XLogP | 4.52 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzyl (3R)-1-benzyl-5-methoxy-2-oxospiro[indole-3,3'-pyrrolidine]-1'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (3R)-1-benzyl-5-methoxy-2-oxospiro[indole-3,3'-pyrrolidine]-1'-carboxylate?
The IUPAC name of benzyl (3R)-1-benzyl-5-methoxy-2-oxospiro[indole-3,3'-pyrrolidine]-1'-carboxylate (CID 10694495) is benzyl (3R)-1-benzyl-5-methoxy-2-oxospiro[indole-3,3'-pyrrolidine]-1'-carboxylate.
What is the SMILES notation for benzyl (3R)-1-benzyl-5-methoxy-2-oxospiro[indole-3,3'-pyrrolidine]-1'-carboxylate?
The canonical SMILES for benzyl (3R)-1-benzyl-5-methoxy-2-oxospiro[indole-3,3'-pyrrolidine]-1'-carboxylate is COc1ccc2c(c1)[C@@]1(CCN(C(=O)OCc3ccccc3)C1)C(=O)N2Cc1ccccc1.
What is the InChIKey of benzyl (3R)-1-benzyl-5-methoxy-2-oxospiro[indole-3,3'-pyrrolidine]-1'-carboxylate?
The InChIKey is IELIIVJBHWMKTI-MHZLTWQESA-N. The full InChI is InChI=1S/C27H26N2O4/c1-32-22-12-13-24-23(16-22)27(25(30)29(24)17-20-8-4-2-5-9-20)14-15-28(19-27)26(31)33-18-21-10-6-3-7-11-21/h2-13,16H,14-15,17-19H2,1H3/t27-/m0/s1.
What are the key properties of benzyl (3R)-1-benzyl-5-methoxy-2-oxospiro[indole-3,3'-pyrrolidine]-1'-carboxylate?
benzyl (3R)-1-benzyl-5-methoxy-2-oxospiro[indole-3,3'-pyrrolidine]-1'-carboxylate has a molecular weight of 442.52 g/mol, XLogP of 4.52, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (3R)-1-benzyl-5-methoxy-2-oxospiro[indole-3,3'-pyrrolidine]-1'-carboxylate is sourced from PubChem (CID 10694495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).