C24H29NO7 — CID 10694545
[(2R,3R,4R,5S)-3,4-diacetyloxy-5-[(1S,3S,4R)-2-benzyl-2-azabicyclo[2.2.1]hept-5-en-3-yl]oxolan-2-yl]methyl acetate (PubChem CID 10694545) has the molecular formula C24H29NO7 and a molecular weight of 443.50 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-3,4-diacetyloxy-5-[(1S,3S,4R)-2-benzyl-2-azabicyclo[2.2.1]hept-5-en-3-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S)-3,4-diacetyloxy-5-[(1S,3S,4R)-2-benzyl-2-azabicyclo[2.2.1]hept-5-en-3-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10694545 |
| Molecular Formula | C24H29NO7 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | [(2R,3R,4R,5S)-3,4-diacetyloxy-5-[(1S,3S,4R)-2-benzyl-2-azabicyclo[2.2.1]hept-5-en-3-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H]([C@@H]2[C@H]3C=C[C@H](C3)N2Cc2ccccc2)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H29NO7/c1-14(26)29-13-20-22(30-15(2)27)24(31-16(3)28)23(32-20)21-18-9-10-19(11-18)25(21)12-17-7-5-4-6-8-17/h4-10,18-24H,11-13H2,1-3H3/t18-,19+,20+,21-,22+,23-,24-/m0/s1 |
| InChIKey | YQDDTZMFGXBHFA-NYKKKEQHSA-N |
| XLogP | 2.01 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|