C13H12BrF2N3O — CID 106945571
[(3-bromo-2,6-difluorophenyl)-(2-methoxy-3-pyridinyl)methyl]hydrazine (PubChem CID 106945571) has the molecular formula C13H12BrF2N3O and a molecular weight of 344.16 g/mol. Its IUPAC name is [(3-bromo-2,6-difluorophenyl)-(2-methoxy-3-pyridinyl)methyl]hydrazine.
| Compound Name | [(3-bromo-2,6-difluorophenyl)-(2-methoxy-3-pyridinyl)methyl]hydrazine |
|---|---|
| PubChem CID | 106945571 |
| Molecular Formula | C13H12BrF2N3O |
| Molecular Weight | 344.16 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | [(3-bromo-2,6-difluorophenyl)-(2-methoxy-3-pyridinyl)methyl]hydrazine |
| SMILES | COc1ncccc1C(NN)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C13H12BrF2N3O/c1-20-13-7(3-2-6-18-13)12(19-17)10-9(15)5-4-8(14)11(10)16/h2-6,12,19H,17H2,1H3 |
| InChIKey | QHAJPJWPPQXMQA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.16 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|