About 9-(2-bromo-4-propan-2-ylphenyl)-N-butyl-N-ethyl-2,8-dimethylpurin-6-amine
9-(2-bromo-4-propan-2-ylphenyl)-N-butyl-N-ethyl-2,8-dimethylpurin-6-amine (PubChem CID 10694584) has the molecular formula C22H30BrN5
and a molecular weight of 444.42 g/mol. Its IUPAC name is 9-(2-bromo-4-propan-2-ylphenyl)-N-butyl-N-ethyl-2,8-dimethylpurin-6-amine.
Molecular Properties
| Compound Name | 9-(2-bromo-4-propan-2-ylphenyl)-N-butyl-N-ethyl-2,8-dimethylpurin-6-amine |
| PubChem CID | 10694584 |
| Molecular Formula | C22H30BrN5 |
| Molecular Weight | 444.42 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 9-(2-bromo-4-propan-2-ylphenyl)-N-butyl-N-ethyl-2,8-dimethylpurin-6-amine |
| SMILES | CCCCN(CC)c1nc(C)nc2c1nc(C)n2-c1ccc(C(C)C)cc1Br |
| InChI | InChI=1S/C22H30BrN5/c1-7-9-12-27(8-2)21-20-22(25-15(5)24-21)28(16(6)26-20)19-11-10-17(14(3)4)13-18(19)23/h10-11,13-14H,7-9,12H2,1-6H3 |
| InChIKey | XMBUSLAAFNHEDA-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.42 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9-(2-bromo-4-propan-2-ylphenyl)-N-butyl-N-ethyl-2,8-dimethylpurin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(2-bromo-4-propan-2-ylphenyl)-N-butyl-N-ethyl-2,8-dimethylpurin-6-amine?
The IUPAC name of 9-(2-bromo-4-propan-2-ylphenyl)-N-butyl-N-ethyl-2,8-dimethylpurin-6-amine (CID 10694584) is 9-(2-bromo-4-propan-2-ylphenyl)-N-butyl-N-ethyl-2,8-dimethylpurin-6-amine.
What is the SMILES notation for 9-(2-bromo-4-propan-2-ylphenyl)-N-butyl-N-ethyl-2,8-dimethylpurin-6-amine?
The canonical SMILES for 9-(2-bromo-4-propan-2-ylphenyl)-N-butyl-N-ethyl-2,8-dimethylpurin-6-amine is CCCCN(CC)c1nc(C)nc2c1nc(C)n2-c1ccc(C(C)C)cc1Br.
What is the InChIKey of 9-(2-bromo-4-propan-2-ylphenyl)-N-butyl-N-ethyl-2,8-dimethylpurin-6-amine?
The InChIKey is XMBUSLAAFNHEDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30BrN5/c1-7-9-12-27(8-2)21-20-22(25-15(5)24-21)28(16(6)26-20)19-11-10-17(14(3)4)13-18(19)23/h10-11,13-14H,7-9,12H2,1-6H3.
What are the key properties of 9-(2-bromo-4-propan-2-ylphenyl)-N-butyl-N-ethyl-2,8-dimethylpurin-6-amine?
9-(2-bromo-4-propan-2-ylphenyl)-N-butyl-N-ethyl-2,8-dimethylpurin-6-amine has a molecular weight of 444.42 g/mol, XLogP of 5.94, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(2-bromo-4-propan-2-ylphenyl)-N-butyl-N-ethyl-2,8-dimethylpurin-6-amine is sourced from PubChem (CID 10694584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).