C14H12F6N4O2 — CID 1069460
N-benzyl-4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine (PubChem CID 1069460) has the molecular formula C14H12F6N4O2 and a molecular weight of 382.26 g/mol. Its IUPAC name is N-benzyl-4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine.
| Compound Name | N-benzyl-4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 1069460 |
| Molecular Formula | C14H12F6N4O2 |
| Molecular Weight | 382.26 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | N-benzyl-4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine |
| SMILES | FC(F)(F)COc1nc(NCc2ccccc2)nc(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C14H12F6N4O2/c15-13(16,17)7-25-11-22-10(21-6-9-4-2-1-3-5-9)23-12(24-11)26-8-14(18,19)20/h1-5H,6-8H2,(H,21,22,23,24) |
| InChIKey | XTWZAAMFTDLUFS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.26 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |