C13H11ClO5 — CID 106947326
5-[(5-chloro-2-methoxyphenyl)-hydroxymethyl]furan-2-carboxylic acid (PubChem CID 106947326) has the molecular formula C13H11ClO5 and a molecular weight of 282.68 g/mol. Its IUPAC name is 5-[(5-chloro-2-methoxyphenyl)-hydroxymethyl]furan-2-carboxylic acid.
| Compound Name | 5-[(5-chloro-2-methoxyphenyl)-hydroxymethyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 106947326 |
| Molecular Formula | C13H11ClO5 |
| Molecular Weight | 282.68 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 5-[(5-chloro-2-methoxyphenyl)-hydroxymethyl]furan-2-carboxylic acid |
| SMILES | COc1ccc(Cl)cc1C(O)c1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C13H11ClO5/c1-18-9-3-2-7(14)6-8(9)12(15)10-4-5-11(19-10)13(16)17/h2-6,12,15H,1H3,(H,16,17) |
| InChIKey | YJSNBZZQUMIRLJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.68 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |