C15H21N3 — CID 106947469
6-N-butyl-6-N-ethylisoquinoline-5,6-diamine (PubChem CID 106947469) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 6-N-butyl-6-N-ethylisoquinoline-5,6-diamine.
| Compound Name | 6-N-butyl-6-N-ethylisoquinoline-5,6-diamine |
|---|---|
| PubChem CID | 106947469 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 6-N-butyl-6-N-ethylisoquinoline-5,6-diamine |
| SMILES | CCCCN(CC)c1ccc2cnccc2c1N |
| InChI | InChI=1S/C15H21N3/c1-3-5-10-18(4-2)14-7-6-12-11-17-9-8-13(12)15(14)16/h6-9,11H,3-5,10,16H2,1-2H3 |
| InChIKey | OFUGOFSCFPETFD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|