C15H20BrN3 — CID 106949135
3-bromo-8-N-methyl-8-N-(3-methylbutyl)quinoline-5,8-diamine (PubChem CID 106949135) has the molecular formula C15H20BrN3 and a molecular weight of 322.25 g/mol. Its IUPAC name is 3-bromo-8-N-methyl-8-N-(3-methylbutyl)quinoline-5,8-diamine.
| Compound Name | 3-bromo-8-N-methyl-8-N-(3-methylbutyl)quinoline-5,8-diamine |
|---|---|
| PubChem CID | 106949135 |
| Molecular Formula | C15H20BrN3 |
| Molecular Weight | 322.25 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 3-bromo-8-N-methyl-8-N-(3-methylbutyl)quinoline-5,8-diamine |
| SMILES | CC(C)CCN(C)c1ccc(N)c2cc(Br)cnc12 |
| InChI | InChI=1S/C15H20BrN3/c1-10(2)6-7-19(3)14-5-4-13(17)12-8-11(16)9-18-15(12)14/h4-5,8-10H,6-7,17H2,1-3H3 |
| InChIKey | LSPUGLXIZKWAPH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.25 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|