About [4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-6-methyl-1H-indol-2-yl]methanol
[4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-6-methyl-1H-indol-2-yl]methanol (PubChem CID 10694918) has the molecular formula C23H41NO4Si2
and a molecular weight of 451.76 g/mol. Its IUPAC name is [4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-6-methyl-1H-indol-2-yl]methanol.
Molecular Properties
| Compound Name | [4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-6-methyl-1H-indol-2-yl]methanol |
| PubChem CID | 10694918 |
| Molecular Formula | C23H41NO4Si2 |
| Molecular Weight | 451.76 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | [4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-6-methyl-1H-indol-2-yl]methanol |
| SMILES | COc1c(C)c(O[Si](C)(C)C(C)(C)C)c2[nH]c(CO)cc2c1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H41NO4Si2/c1-15-19(27-29(9,10)22(2,3)4)18-17(13-16(14-25)24-18)21(20(15)26-8)28-30(11,12)23(5,6)7/h13,24-25H,14H2,1-12H3 |
| InChIKey | QUDIIYUEXPETGJ-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 63.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.76 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-6-methyl-1H-indol-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-6-methyl-1H-indol-2-yl]methanol?
The IUPAC name of [4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-6-methyl-1H-indol-2-yl]methanol (CID 10694918) is [4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-6-methyl-1H-indol-2-yl]methanol.
What is the SMILES notation for [4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-6-methyl-1H-indol-2-yl]methanol?
The canonical SMILES for [4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-6-methyl-1H-indol-2-yl]methanol is COc1c(C)c(O[Si](C)(C)C(C)(C)C)c2[nH]c(CO)cc2c1O[Si](C)(C)C(C)(C)C.
What is the InChIKey of [4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-6-methyl-1H-indol-2-yl]methanol?
The InChIKey is QUDIIYUEXPETGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H41NO4Si2/c1-15-19(27-29(9,10)22(2,3)4)18-17(13-16(14-25)24-18)21(20(15)26-8)28-30(11,12)23(5,6)7/h13,24-25H,14H2,1-12H3.
What are the key properties of [4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-6-methyl-1H-indol-2-yl]methanol?
[4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-6-methyl-1H-indol-2-yl]methanol has a molecular weight of 451.76 g/mol, XLogP of 6.75, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-6-methyl-1H-indol-2-yl]methanol is sourced from PubChem (CID 10694918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).