C13H16BrN3O2S — CID 106949431
3-bromo-8-N-(1-methylsulfonylpropan-2-yl)quinoline-5,8-diamine (PubChem CID 106949431) has the molecular formula C13H16BrN3O2S and a molecular weight of 358.26 g/mol. Its IUPAC name is 3-bromo-8-N-(1-methylsulfonylpropan-2-yl)quinoline-5,8-diamine.
| Compound Name | 3-bromo-8-N-(1-methylsulfonylpropan-2-yl)quinoline-5,8-diamine |
|---|---|
| PubChem CID | 106949431 |
| Molecular Formula | C13H16BrN3O2S |
| Molecular Weight | 358.26 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | 3-bromo-8-N-(1-methylsulfonylpropan-2-yl)quinoline-5,8-diamine |
| SMILES | CC(CS(C)(=O)=O)Nc1ccc(N)c2cc(Br)cnc12 |
| InChI | InChI=1S/C13H16BrN3O2S/c1-8(7-20(2,18)19)17-12-4-3-11(15)10-5-9(14)6-16-13(10)12/h3-6,8,17H,7,15H2,1-2H3 |
| InChIKey | NAYLUSSQPNZKBQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|