C26H46O6 — CID 10695042
[(2S,3S)-3-[(4R,5S)-5-[(Z)-8-(2-hexyl-1,3-dioxolan-2-yl)oct-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methyloxiran-2-yl]methanol (PubChem CID 10695042) has the molecular formula C26H46O6 and a molecular weight of 454.65 g/mol. Its IUPAC name is [(2S,3S)-3-[(4R,5S)-5-[(Z)-8-(2-hexyl-1,3-dioxolan-2-yl)oct-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methyloxiran-2-yl]methanol.
| Compound Name | [(2S,3S)-3-[(4R,5S)-5-[(Z)-8-(2-hexyl-1,3-dioxolan-2-yl)oct-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methyloxiran-2-yl]methanol |
|---|---|
| PubChem CID | 10695042 |
| Molecular Formula | C26H46O6 |
| Molecular Weight | 454.65 g/mol |
| Exact Mass | 454.33 |
| IUPAC Name | [(2S,3S)-3-[(4R,5S)-5-[(Z)-8-(2-hexyl-1,3-dioxolan-2-yl)oct-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methyloxiran-2-yl]methanol |
| SMILES | CCCCCCC1(CCCCCC/C=C\[C@@H]2OC(C)(C)O[C@H]2[C@@H]2O[C@@]2(C)CO)OCCO1 |
| InChI | InChI=1S/C26H46O6/c1-5-6-7-13-16-26(28-18-19-29-26)17-14-11-9-8-10-12-15-21-22(31-24(2,3)30-21)23-25(4,20-27)32-23/h12,15,21-23,27H,5-11,13-14,16-20H2,1-4H3/b15-12-/t21-,22+,23-,25-/m0/s1 |
| InChIKey | XFNYZVGXNKVFHE-LNROBFMDSA-N |
| XLogP | 5.27 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.65 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|