About 2-(3-ethyl-1,4-dithian-2-yl)-1,4-dihydroimidazol-5-one
2-(3-ethyl-1,4-dithian-2-yl)-1,4-dihydroimidazol-5-one (PubChem CID 106951790) has the molecular formula C9H14N2OS2
and a molecular weight of 230.36 g/mol. Its IUPAC name is 2-(3-ethyl-1,4-dithian-2-yl)-1,4-dihydroimidazol-5-one.
Molecular Properties
| Compound Name | 2-(3-ethyl-1,4-dithian-2-yl)-1,4-dihydroimidazol-5-one |
| PubChem CID | 106951790 |
| Molecular Formula | C9H14N2OS2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 2-(3-ethyl-1,4-dithian-2-yl)-1,4-dihydroimidazol-5-one |
| SMILES | CCC1SCCSC1C1=NCC(=O)N1 |
| InChI | InChI=1S/C9H14N2OS2/c1-2-6-8(14-4-3-13-6)9-10-5-7(12)11-9/h6,8H,2-5H2,1H3,(H,10,11,12) |
| InChIKey | CZUSJKRJJKVVRG-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-ethyl-1,4-dithian-2-yl)-1,4-dihydroimidazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-ethyl-1,4-dithian-2-yl)-1,4-dihydroimidazol-5-one?
The IUPAC name of 2-(3-ethyl-1,4-dithian-2-yl)-1,4-dihydroimidazol-5-one (CID 106951790) is 2-(3-ethyl-1,4-dithian-2-yl)-1,4-dihydroimidazol-5-one.
What is the SMILES notation for 2-(3-ethyl-1,4-dithian-2-yl)-1,4-dihydroimidazol-5-one?
The canonical SMILES for 2-(3-ethyl-1,4-dithian-2-yl)-1,4-dihydroimidazol-5-one is CCC1SCCSC1C1=NCC(=O)N1.
What is the InChIKey of 2-(3-ethyl-1,4-dithian-2-yl)-1,4-dihydroimidazol-5-one?
The InChIKey is CZUSJKRJJKVVRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2OS2/c1-2-6-8(14-4-3-13-6)9-10-5-7(12)11-9/h6,8H,2-5H2,1H3,(H,10,11,12).
What are the key properties of 2-(3-ethyl-1,4-dithian-2-yl)-1,4-dihydroimidazol-5-one?
2-(3-ethyl-1,4-dithian-2-yl)-1,4-dihydroimidazol-5-one has a molecular weight of 230.36 g/mol, XLogP of 1.14, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethyl-1,4-dithian-2-yl)-1,4-dihydroimidazol-5-one is sourced from PubChem (CID 106951790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).