About 2-(1-ethoxy-2,2-dimethylpropyl)-1,4-dihydroimidazol-5-one
2-(1-ethoxy-2,2-dimethylpropyl)-1,4-dihydroimidazol-5-one (PubChem CID 106951930) has the molecular formula C10H18N2O2
and a molecular weight of 198.27 g/mol. Its IUPAC name is 2-(1-ethoxy-2,2-dimethylpropyl)-1,4-dihydroimidazol-5-one.
Molecular Properties
| Compound Name | 2-(1-ethoxy-2,2-dimethylpropyl)-1,4-dihydroimidazol-5-one |
| PubChem CID | 106951930 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 2-(1-ethoxy-2,2-dimethylpropyl)-1,4-dihydroimidazol-5-one |
| SMILES | CCOC(C1=NCC(=O)N1)C(C)(C)C |
| InChI | InChI=1S/C10H18N2O2/c1-5-14-8(10(2,3)4)9-11-6-7(13)12-9/h8H,5-6H2,1-4H3,(H,11,12,13) |
| InChIKey | ZGMVNPJHKSGZBY-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1-ethoxy-2,2-dimethylpropyl)-1,4-dihydroimidazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-ethoxy-2,2-dimethylpropyl)-1,4-dihydroimidazol-5-one?
The IUPAC name of 2-(1-ethoxy-2,2-dimethylpropyl)-1,4-dihydroimidazol-5-one (CID 106951930) is 2-(1-ethoxy-2,2-dimethylpropyl)-1,4-dihydroimidazol-5-one.
What is the SMILES notation for 2-(1-ethoxy-2,2-dimethylpropyl)-1,4-dihydroimidazol-5-one?
The canonical SMILES for 2-(1-ethoxy-2,2-dimethylpropyl)-1,4-dihydroimidazol-5-one is CCOC(C1=NCC(=O)N1)C(C)(C)C.
What is the InChIKey of 2-(1-ethoxy-2,2-dimethylpropyl)-1,4-dihydroimidazol-5-one?
The InChIKey is ZGMVNPJHKSGZBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O2/c1-5-14-8(10(2,3)4)9-11-6-7(13)12-9/h8H,5-6H2,1-4H3,(H,11,12,13).
What are the key properties of 2-(1-ethoxy-2,2-dimethylpropyl)-1,4-dihydroimidazol-5-one?
2-(1-ethoxy-2,2-dimethylpropyl)-1,4-dihydroimidazol-5-one has a molecular weight of 198.27 g/mol, XLogP of 0.97, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-ethoxy-2,2-dimethylpropyl)-1,4-dihydroimidazol-5-one is sourced from PubChem (CID 106951930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).