About 2-[2-(2,2-difluoroethoxy)ethyl]-1,4-dihydroimidazol-5-one
2-[2-(2,2-difluoroethoxy)ethyl]-1,4-dihydroimidazol-5-one (PubChem CID 106951967) has the molecular formula C7H10F2N2O2
and a molecular weight of 192.16 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-1,4-dihydroimidazol-5-one.
Molecular Properties
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-1,4-dihydroimidazol-5-one |
| PubChem CID | 106951967 |
| Molecular Formula | C7H10F2N2O2 |
| Molecular Weight | 192.16 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-1,4-dihydroimidazol-5-one |
| SMILES | O=C1CN=C(CCOCC(F)F)N1 |
| InChI | InChI=1S/C7H10F2N2O2/c8-5(9)4-13-2-1-6-10-3-7(12)11-6/h5H,1-4H2,(H,10,11,12) |
| InChIKey | FGDHBSMFOYVQDS-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.16 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2,2-difluoroethoxy)ethyl]-1,4-dihydroimidazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,2-difluoroethoxy)ethyl]-1,4-dihydroimidazol-5-one?
The IUPAC name of 2-[2-(2,2-difluoroethoxy)ethyl]-1,4-dihydroimidazol-5-one (CID 106951967) is 2-[2-(2,2-difluoroethoxy)ethyl]-1,4-dihydroimidazol-5-one.
What is the SMILES notation for 2-[2-(2,2-difluoroethoxy)ethyl]-1,4-dihydroimidazol-5-one?
The canonical SMILES for 2-[2-(2,2-difluoroethoxy)ethyl]-1,4-dihydroimidazol-5-one is O=C1CN=C(CCOCC(F)F)N1.
What is the InChIKey of 2-[2-(2,2-difluoroethoxy)ethyl]-1,4-dihydroimidazol-5-one?
The InChIKey is FGDHBSMFOYVQDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10F2N2O2/c8-5(9)4-13-2-1-6-10-3-7(12)11-6/h5H,1-4H2,(H,10,11,12).
What are the key properties of 2-[2-(2,2-difluoroethoxy)ethyl]-1,4-dihydroimidazol-5-one?
2-[2-(2,2-difluoroethoxy)ethyl]-1,4-dihydroimidazol-5-one has a molecular weight of 192.16 g/mol, XLogP of 0.19, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,2-difluoroethoxy)ethyl]-1,4-dihydroimidazol-5-one is sourced from PubChem (CID 106951967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).