About 2-[(3,5-dimethylphenyl)methyl]-4-methyl-1,4-dihydroimidazol-5-one
2-[(3,5-dimethylphenyl)methyl]-4-methyl-1,4-dihydroimidazol-5-one (PubChem CID 106952008) has the molecular formula C13H16N2O
and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-[(3,5-dimethylphenyl)methyl]-4-methyl-1,4-dihydroimidazol-5-one.
Molecular Properties
| Compound Name | 2-[(3,5-dimethylphenyl)methyl]-4-methyl-1,4-dihydroimidazol-5-one |
| PubChem CID | 106952008 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 2-[(3,5-dimethylphenyl)methyl]-4-methyl-1,4-dihydroimidazol-5-one |
| SMILES | Cc1cc(C)cc(CC2=NC(C)C(=O)N2)c1 |
| InChI | InChI=1S/C13H16N2O/c1-8-4-9(2)6-11(5-8)7-12-14-10(3)13(16)15-12/h4-6,10H,7H2,1-3H3,(H,14,15,16) |
| InChIKey | SAIBUPFTWIAVRD-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(3,5-dimethylphenyl)methyl]-4-methyl-1,4-dihydroimidazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,5-dimethylphenyl)methyl]-4-methyl-1,4-dihydroimidazol-5-one?
The IUPAC name of 2-[(3,5-dimethylphenyl)methyl]-4-methyl-1,4-dihydroimidazol-5-one (CID 106952008) is 2-[(3,5-dimethylphenyl)methyl]-4-methyl-1,4-dihydroimidazol-5-one.
What is the SMILES notation for 2-[(3,5-dimethylphenyl)methyl]-4-methyl-1,4-dihydroimidazol-5-one?
The canonical SMILES for 2-[(3,5-dimethylphenyl)methyl]-4-methyl-1,4-dihydroimidazol-5-one is Cc1cc(C)cc(CC2=NC(C)C(=O)N2)c1.
What is the InChIKey of 2-[(3,5-dimethylphenyl)methyl]-4-methyl-1,4-dihydroimidazol-5-one?
The InChIKey is SAIBUPFTWIAVRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O/c1-8-4-9(2)6-11(5-8)7-12-14-10(3)13(16)15-12/h4-6,10H,7H2,1-3H3,(H,14,15,16).
What are the key properties of 2-[(3,5-dimethylphenyl)methyl]-4-methyl-1,4-dihydroimidazol-5-one?
2-[(3,5-dimethylphenyl)methyl]-4-methyl-1,4-dihydroimidazol-5-one has a molecular weight of 216.28 g/mol, XLogP of 1.76, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,5-dimethylphenyl)methyl]-4-methyl-1,4-dihydroimidazol-5-one is sourced from PubChem (CID 106952008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).