About 2-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-1,4-dihydroimidazol-5-one
2-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-1,4-dihydroimidazol-5-one (PubChem CID 106952068) has the molecular formula C8H12F2N2O2
and a molecular weight of 206.19 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-1,4-dihydroimidazol-5-one.
Molecular Properties
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-1,4-dihydroimidazol-5-one |
| PubChem CID | 106952068 |
| Molecular Formula | C8H12F2N2O2 |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-1,4-dihydroimidazol-5-one |
| SMILES | CC1N=C(CCOCC(F)F)NC1=O |
| InChI | InChI=1S/C8H12F2N2O2/c1-5-8(13)12-7(11-5)2-3-14-4-6(9)10/h5-6H,2-4H2,1H3,(H,11,12,13) |
| InChIKey | WWGZFSRFLXYWBP-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.19 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-1,4-dihydroimidazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-1,4-dihydroimidazol-5-one?
The IUPAC name of 2-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-1,4-dihydroimidazol-5-one (CID 106952068) is 2-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-1,4-dihydroimidazol-5-one.
What is the SMILES notation for 2-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-1,4-dihydroimidazol-5-one?
The canonical SMILES for 2-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-1,4-dihydroimidazol-5-one is CC1N=C(CCOCC(F)F)NC1=O.
What is the InChIKey of 2-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-1,4-dihydroimidazol-5-one?
The InChIKey is WWGZFSRFLXYWBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F2N2O2/c1-5-8(13)12-7(11-5)2-3-14-4-6(9)10/h5-6H,2-4H2,1H3,(H,11,12,13).
What are the key properties of 2-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-1,4-dihydroimidazol-5-one?
2-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-1,4-dihydroimidazol-5-one has a molecular weight of 206.19 g/mol, XLogP of 0.57, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-1,4-dihydroimidazol-5-one is sourced from PubChem (CID 106952068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).