About 2-(6-methoxypyrimidin-4-yl)-4-methyl-1,4-dihydroimidazol-5-one
2-(6-methoxypyrimidin-4-yl)-4-methyl-1,4-dihydroimidazol-5-one (PubChem CID 106952069) has the molecular formula C9H10N4O2
and a molecular weight of 206.20 g/mol. Its IUPAC name is 2-(6-methoxypyrimidin-4-yl)-4-methyl-1,4-dihydroimidazol-5-one.
Molecular Properties
| Compound Name | 2-(6-methoxypyrimidin-4-yl)-4-methyl-1,4-dihydroimidazol-5-one |
| PubChem CID | 106952069 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 2-(6-methoxypyrimidin-4-yl)-4-methyl-1,4-dihydroimidazol-5-one |
| SMILES | COc1cc(C2=NC(C)C(=O)N2)ncn1 |
| InChI | InChI=1S/C9H10N4O2/c1-5-9(14)13-8(12-5)6-3-7(15-2)11-4-10-6/h3-5H,1-2H3,(H,12,13,14) |
| InChIKey | GGAHMMYPOFVENU-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(6-methoxypyrimidin-4-yl)-4-methyl-1,4-dihydroimidazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-methoxypyrimidin-4-yl)-4-methyl-1,4-dihydroimidazol-5-one?
The IUPAC name of 2-(6-methoxypyrimidin-4-yl)-4-methyl-1,4-dihydroimidazol-5-one (CID 106952069) is 2-(6-methoxypyrimidin-4-yl)-4-methyl-1,4-dihydroimidazol-5-one.
What is the SMILES notation for 2-(6-methoxypyrimidin-4-yl)-4-methyl-1,4-dihydroimidazol-5-one?
The canonical SMILES for 2-(6-methoxypyrimidin-4-yl)-4-methyl-1,4-dihydroimidazol-5-one is COc1cc(C2=NC(C)C(=O)N2)ncn1.
What is the InChIKey of 2-(6-methoxypyrimidin-4-yl)-4-methyl-1,4-dihydroimidazol-5-one?
The InChIKey is GGAHMMYPOFVENU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O2/c1-5-9(14)13-8(12-5)6-3-7(15-2)11-4-10-6/h3-5H,1-2H3,(H,12,13,14).
What are the key properties of 2-(6-methoxypyrimidin-4-yl)-4-methyl-1,4-dihydroimidazol-5-one?
2-(6-methoxypyrimidin-4-yl)-4-methyl-1,4-dihydroimidazol-5-one has a molecular weight of 206.20 g/mol, XLogP of -0.25, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-methoxypyrimidin-4-yl)-4-methyl-1,4-dihydroimidazol-5-one is sourced from PubChem (CID 106952069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).