C11H10ClFN2O — CID 106952388
2-[(2-chloro-4-fluorophenyl)methyl]-1-methylimidazol-4-ol (PubChem CID 106952388) has the molecular formula C11H10ClFN2O and a molecular weight of 240.67 g/mol. Its IUPAC name is 2-[(2-chloro-4-fluorophenyl)methyl]-1-methylimidazol-4-ol.
| Compound Name | 2-[(2-chloro-4-fluorophenyl)methyl]-1-methylimidazol-4-ol |
|---|---|
| PubChem CID | 106952388 |
| Molecular Formula | C11H10ClFN2O |
| Molecular Weight | 240.67 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 2-[(2-chloro-4-fluorophenyl)methyl]-1-methylimidazol-4-ol |
| SMILES | Cn1cc(O)nc1Cc1ccc(F)cc1Cl |
| InChI | InChI=1S/C11H10ClFN2O/c1-15-6-11(16)14-10(15)4-7-2-3-8(13)5-9(7)12/h2-3,5-6,16H,4H2,1H3 |
| InChIKey | MZQTXNPHCOREIO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.67 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |