C9H13F3N2O2 — CID 106952572
4-ethyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,4-dihydroimidazol-5-one (PubChem CID 106952572) has the molecular formula C9H13F3N2O2 and a molecular weight of 238.21 g/mol. Its IUPAC name is 4-ethyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,4-dihydroimidazol-5-one.
| Compound Name | 4-ethyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,4-dihydroimidazol-5-one |
|---|---|
| PubChem CID | 106952572 |
| Molecular Formula | C9H13F3N2O2 |
| Molecular Weight | 238.21 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 4-ethyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,4-dihydroimidazol-5-one |
| SMILES | CCC1N=C(CCOCC(F)(F)F)NC1=O |
| InChI | InChI=1S/C9H13F3N2O2/c1-2-6-8(15)14-7(13-6)3-4-16-5-9(10,11)12/h6H,2-5H2,1H3,(H,13,14,15) |
| InChIKey | KEYKTUGCWHJYSB-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.21 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|