About 2-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,4-dihydroimidazol-5-one
2-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,4-dihydroimidazol-5-one (PubChem CID 106952607) has the molecular formula C9H14F2N2O2
and a molecular weight of 220.22 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,4-dihydroimidazol-5-one.
Molecular Properties
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,4-dihydroimidazol-5-one |
| PubChem CID | 106952607 |
| Molecular Formula | C9H14F2N2O2 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,4-dihydroimidazol-5-one |
| SMILES | CCC1N=C(CCOCC(F)F)NC1=O |
| InChI | InChI=1S/C9H14F2N2O2/c1-2-6-9(14)13-8(12-6)3-4-15-5-7(10)11/h6-7H,2-5H2,1H3,(H,12,13,14) |
| InChIKey | GSLOJDDJTXHZLS-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,4-dihydroimidazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,4-dihydroimidazol-5-one?
The IUPAC name of 2-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,4-dihydroimidazol-5-one (CID 106952607) is 2-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,4-dihydroimidazol-5-one.
What is the SMILES notation for 2-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,4-dihydroimidazol-5-one?
The canonical SMILES for 2-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,4-dihydroimidazol-5-one is CCC1N=C(CCOCC(F)F)NC1=O.
What is the InChIKey of 2-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,4-dihydroimidazol-5-one?
The InChIKey is GSLOJDDJTXHZLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F2N2O2/c1-2-6-9(14)13-8(12-6)3-4-15-5-7(10)11/h6-7H,2-5H2,1H3,(H,12,13,14).
What are the key properties of 2-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,4-dihydroimidazol-5-one?
2-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,4-dihydroimidazol-5-one has a molecular weight of 220.22 g/mol, XLogP of 0.97, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,4-dihydroimidazol-5-one is sourced from PubChem (CID 106952607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).