C29H49NO3 — CID 10695263
2-[(1R,3aS,4R,5S,7aR)-5-(6-cyano-5-ethoxyhex-1-en-2-yl)-7a-methyl-1-(6-methylheptan-2-yl)-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]acetic acid (PubChem CID 10695263) has the molecular formula C29H49NO3 and a molecular weight of 459.72 g/mol. Its IUPAC name is 2-[(1R,3aS,4R,5S,7aR)-5-(6-cyano-5-ethoxyhex-1-en-2-yl)-7a-methyl-1-(6-methylheptan-2-yl)-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]acetic acid.
| Compound Name | 2-[(1R,3aS,4R,5S,7aR)-5-(6-cyano-5-ethoxyhex-1-en-2-yl)-7a-methyl-1-(6-methylheptan-2-yl)-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]acetic acid |
|---|---|
| PubChem CID | 10695263 |
| Molecular Formula | C29H49NO3 |
| Molecular Weight | 459.72 g/mol |
| Exact Mass | 459.37 |
| IUPAC Name | 2-[(1R,3aS,4R,5S,7aR)-5-(6-cyano-5-ethoxyhex-1-en-2-yl)-7a-methyl-1-(6-methylheptan-2-yl)-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]acetic acid |
| SMILES | C=C(CCC(CC#N)OCC)[C@H]1CC[C@]2(C)[C@@H](C(C)CCCC(C)C)CC[C@H]2[C@@H]1CC(=O)O |
| InChI | InChI=1S/C29H49NO3/c1-7-33-23(16-18-30)12-11-21(4)24-15-17-29(6)26(22(5)10-8-9-20(2)3)13-14-27(29)25(24)19-28(31)32/h20,22-27H,4,7-17,19H2,1-3,5-6H3,(H,31,32)/t22?,23?,24-,25-,26-,27+,29-/m1/s1 |
| InChIKey | HMATYMVCHXWQLT-NOGLHYDWSA-N |
| XLogP | 7.64 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.72 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|