C22H30Cl2O6 — CID 10695308
(1R,2R)-1-[(2,6-dichlorophenyl)methoxy]-1,2-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-en-2-ol (PubChem CID 10695308) has the molecular formula C22H30Cl2O6 and a molecular weight of 461.38 g/mol. Its IUPAC name is (1R,2R)-1-[(2,6-dichlorophenyl)methoxy]-1,2-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-en-2-ol.
| Compound Name | (1R,2R)-1-[(2,6-dichlorophenyl)methoxy]-1,2-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-en-2-ol |
|---|---|
| PubChem CID | 10695308 |
| Molecular Formula | C22H30Cl2O6 |
| Molecular Weight | 461.38 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | (1R,2R)-1-[(2,6-dichlorophenyl)methoxy]-1,2-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-en-2-ol |
| SMILES | C=CC[C@](O)([C@H](OCc1c(Cl)cccc1Cl)[C@H]1COC(C)(C)O1)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C22H30Cl2O6/c1-6-10-22(25,18-13-28-21(4,5)30-18)19(17-12-27-20(2,3)29-17)26-11-14-15(23)8-7-9-16(14)24/h6-9,17-19,25H,1,10-13H2,2-5H3/t17-,18-,19-,22-/m1/s1 |
| InChIKey | UAMOPZKHULAPAQ-JPAWQOSXSA-N |
| XLogP | 4.49 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.38 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|